C33H36ClN3O6 — CID 155367486
(Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]-N-phenylmethoxybut-2-enamide (PubChem CID 155367486) has the molecular formula C33H36ClN3O6 and a molecular weight of 606.12 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]-N-phenylmethoxybut-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]-N-phenylmethoxybut-2-enamide |
|---|---|
| PubChem CID | 155367486 |
| Molecular Formula | C33H36ClN3O6 |
| Molecular Weight | 606.12 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]-N-phenylmethoxybut-2-enamide |
| SMILES | O=C(/C=C/CNCCCCN1c2ccccc2CCc2ccc(Cl)cc21)NOCc1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C29H32ClN3O2.C4H4O4/c30-26-17-16-25-15-14-24-11-4-5-12-27(24)33(28(25)21-26)20-7-6-18-31-19-8-13-29(34)32-35-22-23-9-2-1-3-10-23;5-3(6)1-2-4(7)8/h1-5,8-13,16-17,21,31H,6-7,14-15,18-20,22H2,(H,32,34);1-2H,(H,5,6)(H,7,8)/b13-8+;2-1- |
| InChIKey | LZZXJDYWTLSPKV-PEEIFYITSA-N |
| XLogP | 5.46 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.12 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|