C25H31ClN2O2 — CID 155383113
ethyl (E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoate (PubChem CID 155383113) has the molecular formula C25H31ClN2O2 and a molecular weight of 426.99 g/mol. Its IUPAC name is ethyl (E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoate |
|---|---|
| PubChem CID | 155383113 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | ethyl (E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCCCN1c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H31ClN2O2/c1-2-30-25(29)11-8-17-27-16-6-3-7-18-28-23-10-5-4-9-20(23)12-13-21-14-15-22(26)19-24(21)28/h4-5,8-11,14-15,19,27H,2-3,6-7,12-13,16-18H2,1H3/b11-8+ |
| InChIKey | SUHHOHBXVWLYCC-DHZHZOJOSA-N |
| XLogP | 5.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|