C27H31ClN2O6 — CID 174189980
(Z)-but-2-enedioic acid;(E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoic acid (PubChem CID 174189980) has the molecular formula C27H31ClN2O6 and a molecular weight of 515.01 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoic acid.
| Compound Name | (Z)-but-2-enedioic acid;(E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 174189980 |
| Molecular Formula | C27H31ClN2O6 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-4-[5-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)pentylamino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CNCCCCCN1c2ccccc2CCc2ccc(Cl)cc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H27ClN2O2.C4H4O4/c24-20-13-12-19-11-10-18-7-2-3-8-21(18)26(22(19)17-20)16-5-1-4-14-25-15-6-9-23(27)28;5-3(6)1-2-4(7)8/h2-3,6-9,12-13,17,25H,1,4-5,10-11,14-16H2,(H,27,28);1-2H,(H,5,6)(H,7,8)/b9-6+;2-1- |
| InChIKey | ZHJDTQRMIFRMMX-YFSTVNRHSA-N |
| XLogP | 4.69 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|