C26H29ClN2O3 — CID 166010066
methyl (E)-4-[4-(9-chloro-3-prop-2-ynoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate (PubChem CID 166010066) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is methyl (E)-4-[4-(9-chloro-3-prop-2-ynoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate.
| Compound Name | methyl (E)-4-[4-(9-chloro-3-prop-2-ynoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate |
|---|---|
| PubChem CID | 166010066 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | methyl (E)-4-[4-(9-chloro-3-prop-2-ynoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate |
| SMILES | C#CCOc1ccc2c(c1)CCc1ccc(Cl)cc1N2CCCCNC/C=C/C(=O)OC |
| InChI | InChI=1S/C26H29ClN2O3/c1-3-17-32-23-12-13-24-21(18-23)9-8-20-10-11-22(27)19-25(20)29(24)16-5-4-14-28-15-6-7-26(30)31-2/h1,6-7,10-13,18-19,28H,4-5,8-9,14-17H2,2H3/b7-6+ |
| InChIKey | WECNGTDXDIDTQO-VOTSOKGWSA-N |
| XLogP | 4.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|