C31H35ClN2O3 — CID 166010153
ethyl (E)-4-[4-(9-chloro-3-phenylmethoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate (PubChem CID 166010153) has the molecular formula C31H35ClN2O3 and a molecular weight of 519.09 g/mol. Its IUPAC name is ethyl (E)-4-[4-(9-chloro-3-phenylmethoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-[4-(9-chloro-3-phenylmethoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate |
|---|---|
| PubChem CID | 166010153 |
| Molecular Formula | C31H35ClN2O3 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | ethyl (E)-4-[4-(9-chloro-3-phenylmethoxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNCCCCN1c2ccc(OCc3ccccc3)cc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C31H35ClN2O3/c1-2-36-31(35)11-8-19-33-18-6-7-20-34-29-17-16-28(37-23-24-9-4-3-5-10-24)21-26(29)13-12-25-14-15-27(32)22-30(25)34/h3-5,8-11,14-17,21-22,33H,2,6-7,12-13,18-20,23H2,1H3/b11-8+ |
| InChIKey | KCGZZRYNPTUDHH-DHZHZOJOSA-N |
| XLogP | 6.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|