About (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid
(E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid (PubChem CID 155367418) has the molecular formula C21H21ClN2O3
and a molecular weight of 384.86 g/mol. Its IUPAC name is (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid |
| PubChem CID | 155367418 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CNCCC(=O)N1c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H21ClN2O3/c22-17-10-9-16-8-7-15-4-1-2-5-18(15)24(19(16)14-17)20(25)11-13-23-12-3-6-21(26)27/h1-6,9-10,14,23H,7-8,11-13H2,(H,26,27)/b6-3+ |
| InChIKey | PUNWVVOUVKJFFS-ZZXKWVIFSA-N |
| XLogP | 3.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid?
The IUPAC name of (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid (CID 155367418) is (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid.
What is the SMILES notation for (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid?
The canonical SMILES for (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid is O=C(O)/C=C/CNCCC(=O)N1c2ccccc2CCc2ccc(Cl)cc21.
What is the InChIKey of (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid?
The InChIKey is PUNWVVOUVKJFFS-ZZXKWVIFSA-N. The full InChI is InChI=1S/C21H21ClN2O3/c22-17-10-9-16-8-7-15-4-1-2-5-18(15)24(19(16)14-17)20(25)11-13-23-12-3-6-21(26)27/h1-6,9-10,14,23H,7-8,11-13H2,(H,26,27)/b6-3+.
What are the key properties of (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid?
(E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid has a molecular weight of 384.86 g/mol, XLogP of 3.72, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[[3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-oxopropyl]amino]but-2-enoic acid is sourced from PubChem (CID 155367418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).