C16H13ClN4O — CID 86728073
2-azido-1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone (PubChem CID 86728073) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is 2-azido-1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone.
| Compound Name | 2-azido-1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone |
|---|---|
| PubChem CID | 86728073 |
| Molecular Formula | C16H13ClN4O |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-azido-1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone |
| SMILES | [N-]=[N+]=NCC(=O)N1c2ccccc2CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H13ClN4O/c17-13-8-7-12-6-5-11-3-1-2-4-14(11)21(15(12)9-13)16(22)10-19-20-18/h1-4,7-9H,5-6,10H2 |
| InChIKey | ILMKPYGZVMNZLH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|