C22H27N3O — CID 89190365
1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-piperidin-1-ylpropan-1-one (PubChem CID 89190365) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-piperidin-1-ylpropan-1-one.
| Compound Name | 1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 89190365 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-3-piperidin-1-ylpropan-1-one |
| SMILES | Nc1ccc2c(c1)N(C(=O)CCN1CCCCC1)c1ccccc1CC2 |
| InChI | InChI=1S/C22H27N3O/c23-19-11-10-18-9-8-17-6-2-3-7-20(17)25(21(18)16-19)22(26)12-15-24-13-4-1-5-14-24/h2-3,6-7,10-11,16H,1,4-5,8-9,12-15,23H2 |
| InChIKey | JCZKJHHINNONJF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|