C20H25N3O — CID 130314398
1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-(diethylamino)ethanone (PubChem CID 130314398) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-(diethylamino)ethanone.
| Compound Name | 1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-(diethylamino)ethanone |
|---|---|
| PubChem CID | 130314398 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-(2-amino-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-(diethylamino)ethanone |
| SMILES | CCN(CC)CC(=O)N1c2ccccc2CCc2ccc(N)cc21 |
| InChI | InChI=1S/C20H25N3O/c1-3-22(4-2)14-20(24)23-18-8-6-5-7-15(18)9-10-16-11-12-17(21)13-19(16)23/h5-8,11-13H,3-4,9-10,14,21H2,1-2H3 |
| InChIKey | JYWCFTMBDWSWGV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|