C21H29ClN2O — CID 15487
benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride (PubChem CID 15487) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride.
| Compound Name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride |
|---|---|
| PubChem CID | 15487 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride |
| SMILES | CC[N+](CC)(CC(=O)Nc1c(C)cccc1C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H28N2O.ClH/c1-5-23(6-2,15-19-13-8-7-9-14-19)16-20(24)22-21-17(3)11-10-12-18(21)4;/h7-14H,5-6,15-16H2,1-4H3;1H |
| InChIKey | YNQALPDYZRNHNK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|