C27H47N2O4+ — CID 130180537
2-decoxycarbonyloxyethyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium (PubChem CID 130180537) has the molecular formula C27H47N2O4+ and a molecular weight of 463.68 g/mol. Its IUPAC name is 2-decoxycarbonyloxyethyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium.
| Compound Name | 2-decoxycarbonyloxyethyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium |
|---|---|
| PubChem CID | 130180537 |
| Molecular Formula | C27H47N2O4+ |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 2-decoxycarbonyloxyethyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium |
| SMILES | CCCCCCCCCCOC(=O)OCC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C27H46N2O4/c1-6-9-10-11-12-13-14-15-20-32-27(31)33-21-19-29(7-2,8-3)22-25(30)28-26-23(4)17-16-18-24(26)5/h16-18H,6-15,19-22H2,1-5H3/p+1 |
| InChIKey | VEBQCRYWBGBUNX-UHFFFAOYSA-O |
| XLogP | 6.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|