C33H53N4O4+ — CID 139405014
[2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[2-[2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]ethoxy]ethoxy]ethyl]-diethylazanium (PubChem CID 139405014) has the molecular formula C33H53N4O4+ and a molecular weight of 569.81 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[2-[2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]ethoxy]ethoxy]ethyl]-diethylazanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[2-[2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]ethoxy]ethoxy]ethyl]-diethylazanium |
|---|---|
| PubChem CID | 139405014 |
| Molecular Formula | C33H53N4O4+ |
| Molecular Weight | 569.81 g/mol |
| Exact Mass | 569.41 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[2-[2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]ethoxy]ethoxy]ethyl]-diethylazanium |
| SMILES | CCCN(CCOCCOCC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C33H52N4O4/c1-8-17-36(24-30(38)34-32-26(4)13-11-14-27(32)5)18-20-40-22-23-41-21-19-37(9-2,10-3)25-31(39)35-33-28(6)15-12-16-29(33)7/h11-16H,8-10,17-25H2,1-7H3,(H-,34,35,38,39)/p+1 |
| InChIKey | DTLUPJOITNZCFB-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|