C16H27N2O+ — CID 3925
[2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium (PubChem CID 3925) has the molecular formula C16H27N2O+ and a molecular weight of 263.40 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 3925 |
| Molecular Formula | C16H27N2O+ |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C16H26N2O/c1-6-18(7-2,8-3)12-15(19)17-16-13(4)10-9-11-14(16)5/h9-11H,6-8,12H2,1-5H3/p+1 |
| InChIKey | PYEBKOFMWAMBFV-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|