C32H51N4O2+ — CID 139406965
[2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl]-ethyl-propylazanium (PubChem CID 139406965) has the molecular formula C32H51N4O2+ and a molecular weight of 523.79 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl]-ethyl-propylazanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl]-ethyl-propylazanium |
|---|---|
| PubChem CID | 139406965 |
| Molecular Formula | C32H51N4O2+ |
| Molecular Weight | 523.79 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl]-ethyl-propylazanium |
| SMILES | CCC[N+](CC)(CCCCCCCNCC(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C32H50N4O2/c1-7-21-36(8-2,24-30(38)35-32-27(5)18-15-19-28(32)6)22-13-11-9-10-12-20-33-23-29(37)34-31-25(3)16-14-17-26(31)4/h14-19,33H,7-13,20-24H2,1-6H3,(H-,34,35,37,38)/p+1 |
| InChIKey | MGSJOVUMWHESAP-UHFFFAOYSA-O |
| XLogP | 6.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.79 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|