C35H57N4O2+ — CID 139404927
7-[butyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium (PubChem CID 139404927) has the molecular formula C35H57N4O2+ and a molecular weight of 565.87 g/mol. Its IUPAC name is 7-[butyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium.
| Compound Name | 7-[butyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium |
|---|---|
| PubChem CID | 139404927 |
| Molecular Formula | C35H57N4O2+ |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 565.45 |
| IUPAC Name | 7-[butyl-[2-(2,6-dimethylanilino)-2-oxoethyl]amino]heptyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium |
| SMILES | CCCCN(CCCCCCC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C35H56N4O2/c1-8-11-23-38(26-32(40)36-34-28(4)19-17-20-29(34)5)24-15-13-12-14-16-25-39(9-2,10-3)27-33(41)37-35-30(6)21-18-22-31(35)7/h17-22H,8-16,23-27H2,1-7H3,(H-,36,37,40,41)/p+1 |
| InChIKey | PQPOOXDOEXYCAT-UHFFFAOYSA-O |
| XLogP | 7.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|