C26H45N2O4+ — CID 130180090
[2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-(2-nonoxycarbonyloxyethyl)azanium (PubChem CID 130180090) has the molecular formula C26H45N2O4+ and a molecular weight of 449.66 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-(2-nonoxycarbonyloxyethyl)azanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-(2-nonoxycarbonyloxyethyl)azanium |
|---|---|
| PubChem CID | 130180090 |
| Molecular Formula | C26H45N2O4+ |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-(2-nonoxycarbonyloxyethyl)azanium |
| SMILES | CCCCCCCCCOC(=O)OCC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C26H44N2O4/c1-6-9-10-11-12-13-14-19-31-26(30)32-20-18-28(7-2,8-3)21-24(29)27-25-22(4)16-15-17-23(25)5/h15-17H,6-14,18-21H2,1-5H3/p+1 |
| InChIKey | BXRJGGFVXIFPSW-UHFFFAOYSA-O |
| XLogP | 6.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|