C27H49N2O4+ — CID 145006226
diethyl-(2-nonoxycarbonyloxyethyl)-(2-oxoethyl)azanium;N,2,6-trimethylaniline (PubChem CID 145006226) has the molecular formula C27H49N2O4+ and a molecular weight of 465.70 g/mol. Its IUPAC name is diethyl-(2-nonoxycarbonyloxyethyl)-(2-oxoethyl)azanium;N,2,6-trimethylaniline.
| Compound Name | diethyl-(2-nonoxycarbonyloxyethyl)-(2-oxoethyl)azanium;N,2,6-trimethylaniline |
|---|---|
| PubChem CID | 145006226 |
| Molecular Formula | C27H49N2O4+ |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 465.37 |
| IUPAC Name | diethyl-(2-nonoxycarbonyloxyethyl)-(2-oxoethyl)azanium;N,2,6-trimethylaniline |
| SMILES | CCCCCCCCCOC(=O)OCC[N+](CC)(CC)CC=O.CNc1c(C)cccc1C |
| InChI | InChI=1S/C18H36NO4.C9H13N/c1-4-7-8-9-10-11-12-16-22-18(21)23-17-14-19(5-2,6-3)13-15-20;1-7-5-4-6-8(2)9(7)10-3/h15H,4-14,16-17H2,1-3H3;4-6,10H,1-3H3/q+1; |
| InChIKey | QLPVEBGMHLJIFL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|