C24H40N2O4 — CID 130251780
2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-ethylamino]ethyl nonyl carbonate (PubChem CID 130251780) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-ethylamino]ethyl nonyl carbonate.
| Compound Name | 2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-ethylamino]ethyl nonyl carbonate |
|---|---|
| PubChem CID | 130251780 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-ethylamino]ethyl nonyl carbonate |
| SMILES | CCCCCCCCCOC(=O)OCCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C24H40N2O4/c1-5-7-8-9-10-11-12-17-29-24(28)30-18-16-26(6-2)19-22(27)25-23-20(3)14-13-15-21(23)4/h13-15H,5-12,16-19H2,1-4H3,(H,25,27) |
| InChIKey | YZYNZTGBOVSVAT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|