C15H24N2O3 — CID 166652856
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;formic acid (PubChem CID 166652856) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;formic acid.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;formic acid |
|---|---|
| PubChem CID | 166652856 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;formic acid |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C.O=CO |
| InChI | InChI=1S/C14H22N2O.CH2O2/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;2-1-3/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H,(H,2,3) |
| InChIKey | YEUIXZMWABTCMO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|