C16H25Cl3N2O3 — CID 67896039
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2,2,2-trichloroethane-1,1-diol (PubChem CID 67896039) has the molecular formula C16H25Cl3N2O3 and a molecular weight of 399.75 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2,2,2-trichloroethane-1,1-diol.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2,2,2-trichloroethane-1,1-diol |
|---|---|
| PubChem CID | 67896039 |
| Molecular Formula | C16H25Cl3N2O3 |
| Molecular Weight | 399.75 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;2,2,2-trichloroethane-1,1-diol |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C.OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22N2O.C2H3Cl3O2/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;3-2(4,5)1(6)7/h7-9H,5-6,10H2,1-4H3,(H,15,17);1,6-7H |
| InChIKey | QOGPPHRREJOBKG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|