C18H30N2O — CID 660469
N-(4-tert-butyl-2,6-dimethylphenyl)-2-(diethylamino)acetamide (PubChem CID 660469) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-(4-tert-butyl-2,6-dimethylphenyl)-2-(diethylamino)acetamide.
| Compound Name | N-(4-tert-butyl-2,6-dimethylphenyl)-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 660469 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-(4-tert-butyl-2,6-dimethylphenyl)-2-(diethylamino)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C18H30N2O/c1-8-20(9-2)12-16(21)19-17-13(3)10-15(11-14(17)4)18(5,6)7/h10-11H,8-9,12H2,1-7H3,(H,19,21) |
| InChIKey | YGSPPIHKUQRPAF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |