C19H33ClN2O — CID 3026196
2-(dibutylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride (PubChem CID 3026196) has the molecular formula C19H33ClN2O and a molecular weight of 340.94 g/mol. Its IUPAC name is 2-(dibutylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride.
| Compound Name | 2-(dibutylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 3026196 |
| Molecular Formula | C19H33ClN2O |
| Molecular Weight | 340.94 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 2-(dibutylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride |
| SMILES | CCCCN(CCCC)CC(=O)Nc1c(C)cc(C)cc1C.Cl |
| InChI | InChI=1S/C19H32N2O.ClH/c1-6-8-10-21(11-9-7-2)14-18(22)20-19-16(4)12-15(3)13-17(19)5;/h12-13H,6-11,14H2,1-5H3,(H,20,22);1H |
| InChIKey | JCVWIBUBMHZMMC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.94 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |