C21H35N3O2 — CID 8635329
2-[[2-[[(2R)-heptan-2-yl]amino]-2-oxoethyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 8635329) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-[[2-[[(2R)-heptan-2-yl]amino]-2-oxoethyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[2-[[(2R)-heptan-2-yl]amino]-2-oxoethyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 8635329 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 2-[[2-[[(2R)-heptan-2-yl]amino]-2-oxoethyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)CN(C)CC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H35N3O2/c1-7-8-9-10-18(5)22-19(25)13-24(6)14-20(26)23-21-16(3)11-15(2)12-17(21)4/h11-12,18H,7-10,13-14H2,1-6H3,(H,22,25)(H,23,26)/t18-/m1/s1 |
| InChIKey | CSKWCAPVBRIEJM-GOSISDBHSA-N |
| XLogP | 3.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|