C14H22BN2O — CID 89442401
CID 89442401 (PubChem CID 89442401) has the molecular formula C14H22BN2O and a molecular weight of 245.16 g/mol.
| Compound Name | CID 89442401 |
|---|---|
| PubChem CID | 89442401 |
| Molecular Formula | C14H22BN2O |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | — |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C.[B] |
| InChI | InChI=1S/C14H22N2O.B/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;/h7-9H,5-6,10H2,1-4H3,(H,15,17); |
| InChIKey | GLXAZCIEPPOTSM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|