C23H30N2O2 — CID 174517449
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;prop-2-ynoxybenzene (PubChem CID 174517449) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;prop-2-ynoxybenzene.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;prop-2-ynoxybenzene |
|---|---|
| PubChem CID | 174517449 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;prop-2-ynoxybenzene |
| SMILES | C#CCOc1ccccc1.CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2O.C9H8O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;1-2-8-10-9-6-4-3-5-7-9/h7-9H,5-6,10H2,1-4H3,(H,15,17);1,3-7H,8H2 |
| InChIKey | GEPVOJILKUEWFO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|