C27H39N3O — CID 87600437
2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;(2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine (PubChem CID 87600437) has the molecular formula C27H39N3O and a molecular weight of 421.63 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;(2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;(2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine |
|---|---|
| PubChem CID | 87600437 |
| Molecular Formula | C27H39N3O |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide;(2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine |
| SMILES | C#CCN(C)[C@H](C)Cc1ccccc1.CCN(CC)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2O.C13H17N/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h7-9H,5-6,10H2,1-4H3,(H,15,17);1,5-9,12H,10-11H2,2-3H3/t;12-/m.1/s1 |
| InChIKey | CJSBOBIBLSZKLV-MBBUEALLSA-N |
| XLogP | 4.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|