C24H34ClN3O2 — CID 24832929
bis[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride (PubChem CID 24832929) has the molecular formula C24H34ClN3O2 and a molecular weight of 432.01 g/mol. Its IUPAC name is bis[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride.
| Compound Name | bis[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride |
|---|---|
| PubChem CID | 24832929 |
| Molecular Formula | C24H34ClN3O2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | bis[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium chloride |
| SMILES | CC[N+](CC)(CC(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C24H33N3O2.ClH/c1-7-27(8-2,15-21(28)25-23-17(3)11-9-12-18(23)4)16-22(29)26-24-19(5)13-10-14-20(24)6;/h9-14H,7-8,15-16H2,1-6H3,(H-,25,26,28,29);1H |
| InChIKey | MNMKAKNWOLULCA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|