C25H35BrN2O3 — CID 134249035
[2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]azanium bromide (PubChem CID 134249035) has the molecular formula C25H35BrN2O3 and a molecular weight of 491.47 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]azanium bromide.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]azanium bromide |
|---|---|
| PubChem CID | 134249035 |
| Molecular Formula | C25H35BrN2O3 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-[[4-(1-methoxy-1-oxopropan-2-yl)phenyl]methyl]azanium bromide |
| SMILES | CC[N+](CC)(CC(=O)Nc1c(C)cccc1C)Cc1ccc(C(C)C(=O)OC)cc1.[Br-] |
| InChI | InChI=1S/C25H34N2O3.BrH/c1-7-27(8-2,17-23(28)26-24-18(3)10-9-11-19(24)4)16-21-12-14-22(15-13-21)20(5)25(29)30-6;/h9-15,20H,7-8,16-17H2,1-6H3;1H |
| InChIKey | CDAHLZSWVHTOLT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|