C22H32N3O+ — CID 155694476
[4-(aminomethyl)phenyl]methyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium (PubChem CID 155694476) has the molecular formula C22H32N3O+ and a molecular weight of 354.52 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]methyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium.
| Compound Name | [4-(aminomethyl)phenyl]methyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium |
|---|---|
| PubChem CID | 155694476 |
| Molecular Formula | C22H32N3O+ |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | [4-(aminomethyl)phenyl]methyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium |
| SMILES | CC[N+](CC)(CC(=O)Nc1c(C)cccc1C)Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C22H31N3O/c1-5-25(6-2,15-20-12-10-19(14-23)11-13-20)16-21(26)24-22-17(3)8-7-9-18(22)4/h7-13H,5-6,14-16,23H2,1-4H3/p+1 |
| InChIKey | PHAMXZLEQHXZPJ-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|