C17H27ClN2O — CID 21463
[2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-prop-2-enylazanium chloride (PubChem CID 21463) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-prop-2-enylazanium chloride.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-prop-2-enylazanium chloride |
|---|---|
| PubChem CID | 21463 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](CC)(CC)CC(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C17H26N2O.ClH/c1-6-12-19(7-2,8-3)13-16(20)18-17-14(4)10-9-11-15(17)5;/h6,9-11H,1,7-8,12-13H2,2-5H3;1H |
| InChIKey | LCEBZNSOOSMNDL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|