C20H27ClN2O — CID 87461534
benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-ethyl-methylazanium chloride (PubChem CID 87461534) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-ethyl-methylazanium chloride.
| Compound Name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-ethyl-methylazanium chloride |
|---|---|
| PubChem CID | 87461534 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-ethyl-methylazanium chloride |
| SMILES | CC[N+](C)(CC(=O)Nc1c(C)cccc1C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H26N2O.ClH/c1-5-22(4,14-18-12-7-6-8-13-18)15-19(23)21-20-16(2)10-9-11-17(20)3;/h6-13H,5,14-15H2,1-4H3;1H |
| InChIKey | TZEKEOVCVSAVOH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|