C21H27ClN3O2+ — CID 20801
[2-(2-chloro-6-methylanilino)-2-oxoethyl]-[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazanium (PubChem CID 20801) has the molecular formula C21H27ClN3O2+ and a molecular weight of 388.92 g/mol. Its IUPAC name is [2-(2-chloro-6-methylanilino)-2-oxoethyl]-[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazanium.
| Compound Name | [2-(2-chloro-6-methylanilino)-2-oxoethyl]-[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 20801 |
| Molecular Formula | C21H27ClN3O2+ |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [2-(2-chloro-6-methylanilino)-2-oxoethyl]-[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazanium |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+](C)(C)CC(=O)Nc1c(C)cccc1Cl |
| InChI | InChI=1S/C21H26ClN3O2/c1-14-8-6-9-15(2)20(14)23-18(26)12-25(4,5)13-19(27)24-21-16(3)10-7-11-17(21)22/h6-11H,12-13H2,1-5H3,(H-,23,24,26,27)/p+1 |
| InChIKey | JHLRCBTUHLMNSE-UHFFFAOYSA-O |
| XLogP | 3.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|