C21H27BrClN3O2 — CID 138399652
N-(2-chloro-6-methylphenyl)-2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazaniumyl]ethanimidate;hydrobromide (PubChem CID 138399652) has the molecular formula C21H27BrClN3O2 and a molecular weight of 468.82 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazaniumyl]ethanimidate;hydrobromide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazaniumyl]ethanimidate;hydrobromide |
|---|---|
| PubChem CID | 138399652 |
| Molecular Formula | C21H27BrClN3O2 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethylazaniumyl]ethanimidate;hydrobromide |
| SMILES | Br.Cc1cccc(Cl)c1/N=C(\[O-])C[N+](C)(C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C21H26ClN3O2.BrH/c1-14-8-6-9-15(2)20(14)23-18(26)12-25(4,5)13-19(27)24-21-16(3)10-7-11-17(21)22;/h6-11H,12-13H2,1-5H3,(H-,23,24,26,27);1H |
| InChIKey | RXBYCKQMMVFWAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|