C21H28N3O3+ — CID 24833235
[2-(2,6-dimethylanilino)-2-oxoethyl]-dimethyl-[2-(phenylcarbamoyloxy)ethyl]azanium (PubChem CID 24833235) has the molecular formula C21H28N3O3+ and a molecular weight of 370.47 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-dimethyl-[2-(phenylcarbamoyloxy)ethyl]azanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-dimethyl-[2-(phenylcarbamoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 24833235 |
| Molecular Formula | C21H28N3O3+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-dimethyl-[2-(phenylcarbamoyloxy)ethyl]azanium |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+](C)(C)CCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H27N3O3/c1-16-9-8-10-17(2)20(16)23-19(25)15-24(3,4)13-14-27-21(26)22-18-11-6-5-7-12-18/h5-12H,13-15H2,1-4H3,(H-,22,23,25,26)/p+1 |
| InChIKey | IVAFQQRKEDHJFQ-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|