C18H30NOP — CID 23405277
2-ditert-butylphosphanyl-N-(2,6-dimethylphenyl)acetamide (PubChem CID 23405277) has the molecular formula C18H30NOP and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-ditert-butylphosphanyl-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-ditert-butylphosphanyl-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23405277 |
| Molecular Formula | C18H30NOP |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-ditert-butylphosphanyl-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CP(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H30NOP/c1-13-10-9-11-14(2)16(13)19-15(20)12-21(17(3,4)5)18(6,7)8/h9-11H,12H2,1-8H3,(H,19,20) |
| InChIKey | DJFJCNKSPFMZLE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|