C19H24N3O2+ — CID 123545617
bis(2-anilino-2-oxoethyl)-ethyl-methylazanium (PubChem CID 123545617) has the molecular formula C19H24N3O2+ and a molecular weight of 326.42 g/mol. Its IUPAC name is bis(2-anilino-2-oxoethyl)-ethyl-methylazanium.
| Compound Name | bis(2-anilino-2-oxoethyl)-ethyl-methylazanium |
|---|---|
| PubChem CID | 123545617 |
| Molecular Formula | C19H24N3O2+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | bis(2-anilino-2-oxoethyl)-ethyl-methylazanium |
| SMILES | CC[N+](C)(CC(=O)Nc1ccccc1)CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H23N3O2/c1-3-22(2,14-18(23)20-16-10-6-4-7-11-16)15-19(24)21-17-12-8-5-9-13-17/h4-13H,3,14-15H2,1-2H3,(H-,20,21,23,24)/p+1 |
| InChIKey | WULINJJVLDVFEM-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|