C30H46N4O2 — CID 155395021
2-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]heptylamino]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 155395021) has the molecular formula C30H46N4O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is 2-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]heptylamino]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]heptylamino]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 155395021 |
| Molecular Formula | C30H46N4O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | 2-[7-[[2-(2,6-dimethylanilino)-2-oxoethyl]-propylamino]heptylamino]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CCCN(CCCCCCCNCC(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C30H46N4O2/c1-6-19-34(22-28(36)33-30-25(4)16-13-17-26(30)5)20-11-9-7-8-10-18-31-21-27(35)32-29-23(2)14-12-15-24(29)3/h12-17,31H,6-11,18-22H2,1-5H3,(H,32,35)(H,33,36) |
| InChIKey | NXVUWAWODUWEDY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|