C22H38N4O2 — CID 155395195
N-(2,6-dimethylphenyl)-2-[5-[2-(2-oxoethylamino)ethylamino]pentyl-propylamino]acetamide (PubChem CID 155395195) has the molecular formula C22H38N4O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[5-[2-(2-oxoethylamino)ethylamino]pentyl-propylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[5-[2-(2-oxoethylamino)ethylamino]pentyl-propylamino]acetamide |
|---|---|
| PubChem CID | 155395195 |
| Molecular Formula | C22H38N4O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[5-[2-(2-oxoethylamino)ethylamino]pentyl-propylamino]acetamide |
| SMILES | CCCN(CCCCCNCCNCC=O)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C22H38N4O2/c1-4-15-26(16-7-5-6-11-23-12-13-24-14-17-27)18-21(28)25-22-19(2)9-8-10-20(22)3/h8-10,17,23-24H,4-7,11-16,18H2,1-3H3,(H,25,28) |
| InChIKey | JQQGBEOQKGJVQX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|