C35H55ClN3O2+ — CID 158132568
butyl-[3-(2-chloro-6-methylphenyl)-2-oxopropyl]-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]octyl]-propylazanium (PubChem CID 158132568) has the molecular formula C35H55ClN3O2+ and a molecular weight of 585.30 g/mol. Its IUPAC name is butyl-[3-(2-chloro-6-methylphenyl)-2-oxopropyl]-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]octyl]-propylazanium.
| Compound Name | butyl-[3-(2-chloro-6-methylphenyl)-2-oxopropyl]-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]octyl]-propylazanium |
|---|---|
| PubChem CID | 158132568 |
| Molecular Formula | C35H55ClN3O2+ |
| Molecular Weight | 585.30 g/mol |
| Exact Mass | 584.40 |
| IUPAC Name | butyl-[3-(2-chloro-6-methylphenyl)-2-oxopropyl]-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]octyl]-propylazanium |
| SMILES | CCCC[N+](CCC)(CCCCCCCCNCC(=O)Nc1c(C)cccc1C)CC(=O)Cc1c(C)cccc1Cl |
| InChI | InChI=1S/C35H54ClN3O2/c1-6-8-23-39(22-7-2,27-31(40)25-32-28(3)17-16-20-33(32)36)24-14-12-10-9-11-13-21-37-26-34(41)38-35-29(4)18-15-19-30(35)5/h15-20,37H,6-14,21-27H2,1-5H3/p+1 |
| InChIKey | FSYOUYXURFZQJZ-UHFFFAOYSA-O |
| XLogP | 7.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.30 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|