C11H14Cl2N2O2 — CID 43405278
N-(2,6-dichlorophenyl)-2-(3-hydroxypropylamino)acetamide (PubChem CID 43405278) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(3-hydroxypropylamino)acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(3-hydroxypropylamino)acetamide |
|---|---|
| PubChem CID | 43405278 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(3-hydroxypropylamino)acetamide |
| SMILES | O=C(CNCCCO)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O2/c12-8-3-1-4-9(13)11(8)15-10(17)7-14-5-2-6-16/h1,3-4,14,16H,2,5-7H2,(H,15,17) |
| InChIKey | LEMVKDDSWNSSSO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|