C13H19Cl2N3O — CID 62642488
N-(2,6-dichlorophenyl)-2-[2-[ethyl(methyl)amino]ethylamino]acetamide (PubChem CID 62642488) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[2-[ethyl(methyl)amino]ethylamino]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[2-[ethyl(methyl)amino]ethylamino]acetamide |
|---|---|
| PubChem CID | 62642488 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[2-[ethyl(methyl)amino]ethylamino]acetamide |
| SMILES | CCN(C)CCNCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H19Cl2N3O/c1-3-18(2)8-7-16-9-12(19)17-13-10(14)5-4-6-11(13)15/h4-6,16H,3,7-9H2,1-2H3,(H,17,19) |
| InChIKey | DDLKFAUQRDDMMO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|