C37H59N4O2+ — CID 139406977
[2-(2,6-dimethylanilino)-2-oxoethyl]-[8-[2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]octyl]-ethyl-propylazanium (PubChem CID 139406977) has the molecular formula C37H59N4O2+ and a molecular weight of 591.91 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-[8-[2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]octyl]-ethyl-propylazanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[8-[2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]octyl]-ethyl-propylazanium |
|---|---|
| PubChem CID | 139406977 |
| Molecular Formula | C37H59N4O2+ |
| Molecular Weight | 591.91 g/mol |
| Exact Mass | 591.46 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[8-[2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]octyl]-ethyl-propylazanium |
| SMILES | CCC[N+](CC)(CCCCCCCCN1CCCCC1C(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C37H58N4O2/c1-7-26-41(8-2,28-34(42)38-35-29(3)19-17-20-30(35)4)27-16-12-10-9-11-14-24-40-25-15-13-23-33(40)37(43)39-36-31(5)21-18-22-32(36)6/h17-22,33H,7-16,23-28H2,1-6H3,(H-,38,39,42,43)/p+1 |
| InChIKey | QNAVVYUUYVPGNP-UHFFFAOYSA-O |
| XLogP | 7.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.91 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|