C17H28ClN2O2- — CID 170923314
(2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;chloride;hydrate (PubChem CID 170923314) has the molecular formula C17H28ClN2O2- and a molecular weight of 327.88 g/mol. Its IUPAC name is (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;chloride;hydrate.
| Compound Name | (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;chloride;hydrate |
|---|---|
| PubChem CID | 170923314 |
| Molecular Formula | C17H28ClN2O2- |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;chloride;hydrate |
| SMILES | CCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.O.[Cl-] |
| InChI | InChI=1S/C17H26N2O.ClH.H2O/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;;/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1H;1H2/p-1/t15-;;/m0../s1 |
| InChIKey | VSHFRHVKMYGBJL-CKUXDGONSA-M |
| XLogP | -0.31 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |