C19H32N2O2 — CID 66709536
1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;methanol (PubChem CID 66709536) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;methanol.
| Compound Name | 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;methanol |
|---|---|
| PubChem CID | 66709536 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;methanol |
| SMILES | CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C.CO |
| InChI | InChI=1S/C18H28N2O.CH4O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;1-2/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);2H,1H3 |
| InChIKey | FOWIURHHGZPMOV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |