C18H28ClN2O- — CID 154730536
(2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide chloride (PubChem CID 154730536) has the molecular formula C18H28ClN2O- and a molecular weight of 323.89 g/mol. Its IUPAC name is (2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide chloride.
| Compound Name | (2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide chloride |
|---|---|
| PubChem CID | 154730536 |
| Molecular Formula | C18H28ClN2O- |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide chloride |
| SMILES | CCCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C18H28N2O.ClH/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);1H/p-1/t16-;/m0./s1 |
| InChIKey | SIEYLFHKZGLBNX-NTISSMGPSA-M |
| XLogP | 0.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |