C18H31N2O5P — CID 66615074
(2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;phosphoric acid (PubChem CID 66615074) has the molecular formula C18H31N2O5P and a molecular weight of 386.43 g/mol. Its IUPAC name is (2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;phosphoric acid.
| Compound Name | (2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;phosphoric acid |
|---|---|
| PubChem CID | 66615074 |
| Molecular Formula | C18H31N2O5P |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2S)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;phosphoric acid |
| SMILES | CCCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.O=P(O)(O)O |
| InChI | InChI=1S/C18H28N2O.H3O4P/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;1-5(2,3)4/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);(H3,1,2,3,4)/t16-;/m0./s1 |
| InChIKey | IZVSZWZWKSLTOT-NTISSMGPSA-N |
| XLogP | 2.97 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|