C18H28ClFN2O — CID 174853104
N-(2,6-dimethylphenyl)-1-(4-fluorobutyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 174853104) has the molecular formula C18H28ClFN2O and a molecular weight of 342.89 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1-(4-fluorobutyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-1-(4-fluorobutyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 174853104 |
| Molecular Formula | C18H28ClFN2O |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1-(4-fluorobutyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCCN1CCCCF.Cl |
| InChI | InChI=1S/C18H27FN2O.ClH/c1-14-8-7-9-15(2)17(14)20-18(22)16-10-3-5-12-21(16)13-6-4-11-19;/h7-9,16H,3-6,10-13H2,1-2H3,(H,20,22);1H |
| InChIKey | OKKPJYDSGYOHPI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|