C21H33FN2O — CID 156775827
(2S)-N-(2,6-diethylphenyl)-1-(5-fluoropentyl)piperidine-2-carboxamide (PubChem CID 156775827) has the molecular formula C21H33FN2O and a molecular weight of 348.51 g/mol. Its IUPAC name is (2S)-N-(2,6-diethylphenyl)-1-(5-fluoropentyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(2,6-diethylphenyl)-1-(5-fluoropentyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 156775827 |
| Molecular Formula | C21H33FN2O |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (2S)-N-(2,6-diethylphenyl)-1-(5-fluoropentyl)piperidine-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)[C@@H]1CCCCN1CCCCCF |
| InChI | InChI=1S/C21H33FN2O/c1-3-17-11-10-12-18(4-2)20(17)23-21(25)19-13-6-9-16-24(19)15-8-5-7-14-22/h10-12,19H,3-9,13-16H2,1-2H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | ZUPYSGANWXFRQS-IBGZPJMESA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|