C36H56N4O2 — CID 77242336
1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide (PubChem CID 77242336) has the molecular formula C36H56N4O2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide.
| Compound Name | 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 77242336 |
| Molecular Formula | C36H56N4O2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
| SMILES | CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C.CCCCN1CCCCC1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/2C18H28N2O/c2*1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h2*8-10,16H,4-7,11-13H2,1-3H3,(H,19,21) |
| InChIKey | DXSMVIDEKFJHNT-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |