C26H34N2O3 — CID 129031588
(2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;(E)-3-phenylprop-2-enoic acid (PubChem CID 129031588) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;(E)-3-phenylprop-2-enoic acid.
| Compound Name | (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;(E)-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 129031588 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;(E)-3-phenylprop-2-enoic acid |
| SMILES | CCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.O=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H26N2O.C9H8O2/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;10-9(11)7-6-8-4-2-1-3-5-8/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1-7H,(H,10,11)/b;7-6+/t15-;/m0./s1 |
| InChIKey | MHFYSFLZRDFCDH-OKAQFITISA-N |
| XLogP | 5.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|